$2.5T
Marktkapitalisierung
$76.65B
24-Stunden-Volumen
BTC 50.91%     ETH 15.11%
Dominanz

Top Liquid Staking-Token Coins nach Marktkapitalisierung

Entdecken Sie die Leistungsmetriken für Liquid Staking-Token-Kategorie-Token
Liquid Staking-Token (95)
100 Prev Next 100
#
#
Name
Preis 24h%
7d chart
% 24Std
Marktkap. 24Std Hoch 24Std Tief Preisdiagramme 7 Tage 24Std volumen FDV Marktkap. Prognose
# Name Preis % 24Std Marktkap. 24Std Hoch 24Std Tief Preisdiagramme 7 Tage 24Std volumen FDV Marktkap. Prognose
{{ item.sort }} {{ item.name }}  {{ item.ticker }} {{ item.price }}
{{ item.price_btc }}
{{ item.change_24h_pct }}
{{ item.market_cap }}
{{ item.market_cap_btc }}
{{ item.high_24h }}
{{ item.high_24h_btc }}
{{ item.low_24h }}
{{ item.low_24h_btc }}
{{ item.volume_24h }}
{{ item.volume_24h_btc }}
{{ item.fully_diluted_valuation }}
{{ item.fully_diluted_valuation_btc }}
{{ item.market_cap }}
{{ item.market_cap_btc }}
7 Staked Ether  STETH $3,151.41
₿0.050
1.79 $29.4B
₿481.74K
$3,165.37
₿0.051
$3,018.9
₿0.050
$83.76M
₿2.45K
$29.4B
₿481.74K
$29.4B
₿481.74K
Staked Ether(steth)-Preisprognose
40 Renzo Restaked ETH  EZETH $3,181.06
₿0.051
1.95 $3.17B
₿0
$3,187.55
₿0.051
$3,056.66
₿0.050
$76.53M
₿585.21
$3.18B
$3.17B
₿0
Renzo Restaked ETH(ezeth)-Preisprognose
63 Rocket Pool ETH  RETH $3,483.98
₿0.056
1.85 $1.81B
₿29.52K
$3,492.89
₿0.056
$3,338.45
₿0.055
$15.27M
₿604.25
$1.81B
₿29.52K
$1.81B
₿29.52K
Rocket Pool ETH(reth)-Preisprognose
70 Mantle Staked Ether  METH $3,225.57
₿0.051
1.55 $1.56B
₿25.31K
$3,243.92
₿0.052
$3,098.91
₿0.051
$4.13M
₿159.95
$1.56B
₿25.31K
$1.56B
₿25.31K
Mantle Staked Ether(meth)-Preisprognose
82 ether.fi Staked ETH  EETH $3,155.46
₿0.051
2.16 $1.22B
₿20.76K
$3,156.05
₿0.051
$2,996.75
₿0.050
$142.52K
₿2.15
$3.61B
₿54.93K
$1.22B
₿20.76K
ether.fi Staked ETH(eeth)-Preisprognose
110 Marinade staked SOL  MSOL $178.22
₿0.0028
4.44 $920.42M
₿15.18K
$178.94
₿0.0030
$165.74
₿0.0028
$12.83M
₿73.52
$920.43M
₿15.18K
$920.42M
₿15.18K
Marinade staked SOL(msol)-Preisprognose
120 Kelp DAO Restaked ETH  RSETH $3,183.42
₿0.051
1.97 $781.2M
₿11.81K
$3,189.91
₿0.051
$3,049.76
₿0.050
$2.16M
₿99.91
$781.2M
₿11.81K
$781.2M
₿11.81K
Kelp DAO Restaked ETH(rseth)-Preisprognose
129 Frax Ether  FRXETH $3,149.56
₿0.051
2.06 $694.13M
₿13K
$3,155.58
₿0.051
$2,999.6
₿0.050
$9.04M
₿97.69
$694.13M
₿13K
$694.13M
₿13K
Frax Ether(frxeth)-Preisprognose
130 Lido Staked SOL  STSOL $177.5
₿0.0028
4.25 $692.43M
₿11.19K
$178.27
₿0.0030
$165.33
₿0.0028
$676.49K
₿1.88
$692.43M
₿11.19K
$692.43M
₿11.19K
Lido Staked SOL(stsol)-Preisprognose
133 Swell Ethereum  SWETH $3,312.2
₿0.053
1.83 $671.79M
₿11.03K
$3,323.72
₿0.054
$3,174.76
₿0.052
$2.24M
₿54.8
$671.79M
₿11.03K
$671.79M
₿11.03K
Swell Ethereum(sweth)-Preisprognose
148 Coinbase Wrapped Staked ETH  CBETH $3,355.23
₿0.053
1.67 $588.92M
₿9.54K
$3,369.04
₿0.054
$3,221.87
₿0.053
$2.65M
₿151.43
$4.91B
₿78.73K
$588.92M
₿9.54K
Coinbase Wrapped Staked ETH(cbeth)-Preisprognose
159 Staked Frax Ether  SFRXETH $3,410.19
₿0.054
1.91 $513.16M
₿8.67K
$3,425.94
₿0.055
$3,272.87
₿0.054
$1.23M
₿11.36
$513.15M
₿8.67K
$513.16M
₿8.67K
Staked Frax Ether(sfrxeth)-Preisprognose
205 Stader ETHx  ETHX $3,230.21
₿0.051
1.63 $386.42M
₿6.4K
$3,245.12
₿0.052
$3,098.49
₿0.051
$322.88K
₿15.05
$386.42M
₿6.4K
$386.42M
₿6.4K
Stader ETHx(ethx)-Preisprognose
238 BENQI Liquid Staked AVAX  SAVAX $43.42
₿0.00077
8.42 $285.95M
₿5.14K
$43.41
₿0.00078
$39
₿0.00076
$1.65M
₿25.86
$285.95M
₿5.14K
$285.95M
₿5.14K
BENQI Liquid Staked AVAX(savax)-Preisprognose
455 Stader MaticX  MATICX $0.8176
₿0.000014
9.04 $111.14M
₿1.94K
$0.8181
₿0.000014
$0.7366
₿0.000014
$125.83K
₿5.02
$111.14M
₿1.94K
$111.14M
₿1.94K
Stader MaticX(maticx)-Preisprognose
580 sETH2  SETH2 $3,130.72
₿0.050
2.27 $70.96M
₿1.15K
$3,139.74
₿0.051
$2,964.34
₿0.050
$139.84
₿0.01
$70.96M
₿1.15K
$70.96M
₿1.15K
sETH2(seth2)-Preisprognose
623 StakeWise Staked ETH  OSETH $3,201.82
₿0.051
1.73 $62.58M
₿1.48K
$3,212.17
₿0.052
$3,073.31
₿0.051
$295.45K
₿4.13
$62.58M
₿1.48K
$62.58M
₿1.48K
StakeWise Staked ETH(oseth)-Preisprognose
633 ankrETH  ANKRETH $3,619.05
₿0.058
1.80 $61.28M
₿1.04K
$3,641.03
₿0.059
$3,480.86
₿0.058
$32.26K
₿0.61
$61.28M
₿1.04K
$61.28M
₿1.04K
ankrETH(ankreth)-Preisprognose
742 TruFin Staked MATIC  TRUMATIC $0.7656
₿0.000013
8.28 $45.32M
₿781.25
$0.7687
₿0.000013
$0.691
₿0.000013
$2.21K
₿0.03
$45.32M
₿781.25
$45.32M
₿781.25
TruFin Staked MATIC(trumatic)-Preisprognose
801 Socean Staked Sol  INF $180.16
₿0.0029
4.48 $39.35M
₿650.73
$180.98
₿0.0030
$167.57
₿0.0029
$5.72M
₿48.78
$120.51M
₿1.99K
$39.35M
₿650.73
Socean Staked Sol(inf)-Preisprognose
835 Stride Staked Atom  STATOM $11.46
₿0.00020
5.51 $36.81M
₿647.71
$11.47
₿0.00021
$10.68
₿0.00020
$228.74K
₿7.3
$36.81M
₿647.71
$36.81M
₿647.71
Stride Staked Atom(statom)-Preisprognose
1018 Stride Staked Osmo  STOSMO $1.19
₿0.000022
4.55 $24.29M
₿453.11
$1.19
₿0.000023
$1.12
₿0.000022
$6.18K
₿0.69
$24.29M
₿453.11
$24.29M
₿453.11
Stride Staked Osmo(stosmo)-Preisprognose
1266 Bridge Oracle  BRG $0.001795
₿0.000000025
18.28 $14.36M
₿201.89
$0.001867
₿0.000000025
$0.001502
₿0.000000020
$802.56K
₿25.64
$17.95M
₿252.36
$14.36M
₿201.89
Bridge Oracle(brg)-Preisprognose
2079 rETH2  RETH2 $3,124.69
₿0.050
3.08 $2.86M
₿45.49
$3,134.66
₿0.050
$3,031.1
₿0.050
$35.47
₿0
$2.86M
₿45.49
$2.86M
₿45.49
rETH2(reth2)-Preisprognose
2240 Diversified Staked ETH  DSETH $3,299.43
₿0.053
3.93 $2.17M
₿34.85
$3,299.43
$3,167.54
$18.8
₿1.38
$2.17M
₿34.85
$2.17M
₿34.85
Diversified Staked ETH(dseth)-Preisprognose
2666 Stride Staked Juno  STJUNO $0.327
₿0.0000054
8.53 $1.02M
₿17.11
$0.3279
₿0.0000059
$0.296
₿0.0000054
$215.69
₿0.03
$1.02M
₿17.11
$1.02M
₿17.11
Stride Staked Juno(stjuno)-Preisprognose
2779 Stride Staked Injective  STINJ $35.88
₿0.00057
4.19 $833.26K
₿12.78
$36.04
₿0.00059
$33.57
₿0.00057
$76.78K
₿0.81
$833.26K
₿12.78
$833.26K
₿12.78
Stride Staked Injective(stinj)-Preisprognose
2792 Stride Staked Stars  STSTARS $0.03455
₿0.00000064
9.80 $801.45K
₿22.86
$0.03483
₿0.00000065
$0.03098
₿0.00000058
$199.75
₿0.03
$801.45K
₿22.86
$801.45K
₿22.86
Stride Staked Stars(ststars)-Preisprognose
3579 Stride Staked Luna  $STLUNA $0.928
₿0.000014
-5.81 $155.35K
₿2.34
$1.66
₿0.000025
$0.9283
₿0.000014
$2.39
₿0
$152.98K
₿2.34
$155.35K
₿2.34
Stride Staked Luna($stluna)-Preisprognose
Amnis Staked Aptos Coin  STAPT $10.47
₿0.00018
6.74 $0
₿0
$10.54
₿0.00020
$9.58
₿0.00018
$426.94K
₿5.26
$21.1M
₿367.97
$0
₿0
Amnis Staked Aptos Coin(stapt)-Preisprognose
Jito Staked SOL  JITOSOL $166.37
₿0.0026
4.34 $0
₿0
$167.42
₿0.0028
$154.79
₿0.0026
$38.69M
₿165.53
$0
$0
₿0
Jito Staked SOL(jitosol)-Preisprognose
Stader LunaX Classic  LUNAX $0.01336
₿0.00000051
0 $0
₿0
$0
₿0.
$0
₿0.
$35.42
₿0
$0
$0
₿0
Stader LunaX Classic(lunax)-Preisprognose
Wrapped Staked Tether  WSTUSDT $1.01
₿0.000015
0.33 $0
₿0
$1.03
₿0.000015
$0.9809
₿0.000014
$4.14M
₿52.19
$21.85K
₿0.33
$0
₿0
Wrapped Staked Tether(wstusdt)-Preisprognose
StaFi Staked BNB  RBNB $687.99
₿0.0099
3.45 $0
₿0
$643.68
₿0.0099
$621.16
₿0.0095
$1.51K
₿0
$0
$0
₿0
StaFi Staked BNB(rbnb)-Preisprognose
StaFi Staked MATIC  RMATIC $0.8623
₿0.000014
9.11 $0
₿0
$0.864
₿0.000015
$0.7864
₿0.000014
$207.52
₿0.4
$0
$0
₿0
StaFi Staked MATIC(rmatic)-Preisprognose
Ankr Staked FTM  ANKRFTM $0.8197
₿0.000015
8.56 $0
₿0
$0.8201
₿0.000016
$0.7535
₿0.000014
$425.54
₿0.04
$98.07K
₿1.89
$0
₿0
Ankr Staked FTM(ankrftm)-Preisprognose
Liquid Staking Crescent  BCRE $0.0003225
₿0.0000000053
-22.55 $0
₿0
$0.0004236
₿0.0000000054
$0.0003025
₿0.0000000053
$1.93K
₿0
$0
$0
₿0
Liquid Staking Crescent(bcre)-Preisprognose
ClayStack Staked ETH  CSETH $0
0 $0
$0
$0
$0
$0
$0
ClayStack Staked ETH(cseth)-Preisprognose
Liquid Staked ETH  LSETH $3,292.09
₿0.053
1.78 $0
₿0
$3,309.22
₿0.053
$3,166.61
₿0.052
$537.96
₿1.08
$235.06M
₿3.56K
$0
₿0
Liquid Staked ETH(lseth)-Preisprognose
Staked NEAR  STNEAR $7.92
₿0.00012
8.65 $0
₿0
$7.93
₿0.00013
$7.07
₿0.00012
$271.88K
₿0.09
$0
$0
₿0
Staked NEAR(stnear)-Preisprognose
Liquid Staked ETH Index  LSETH $1,782.35
₿0.063
0 $0
₿0
$0
₿0.
$0
₿0.
$70.76
₿0
$132.55K
₿4.7
$0
₿0
Liquid Staked ETH Index(lseth)-Preisprognose
Binance ETH  BETH $3,262.48
₿0.050
1.95 $0
₿0
$3,273.87
₿0.052
$3,127.93
₿0.050
$12.09K
₿40.64
$328.55M
₿5.11K
$0
₿0
Binance ETH(beth)-Preisprognose
Staked Aurora  STAUR $0
0 $0
$0
$0
$0
$0
$0
Staked Aurora(staur)-Preisprognose
Liquid Staked Canto  SCANTO $0.2106
₿0.0000031
-8.14 $0
₿0
$0.2252
₿0.0000034
$0.2058
₿0.0000031
$1.07
₿0
$0
$0
₿0
Liquid Staked Canto(scanto)-Preisprognose
pSTAKE Staked OSMO  STKOSMO $0.9886
₿0.000018
4.46 $0
₿0
$0.9903
₿0.000019
$0.9254
₿0.000018
$2.66K
₿0.15
$0
$0
₿0
pSTAKE Staked OSMO(stkosmo)-Preisprognose
Volo Staked SUI  VSUI $1.44
₿0.000022
5.67 $0
₿0
$1.44
₿0.000023
$1.33
₿0.000021
$241.8K
₿8.89
$405.92K
₿6.25
$0
₿0
Volo Staked SUI(vsui)-Preisprognose
Haedal Staked SUI  HASUI $1.45
₿0.000022
5.37 $0
₿0
$1.45
₿0.000024
$1.34
₿0.000022
$1.59M
₿22.72
$0
$0
₿0
Haedal Staked SUI(hasui)-Preisprognose
Eth 2.0 Staking by Pool-X  ETH2 $3,146.78
₿0.050
2.10 $0
₿0
$3,153.28
₿0.051
$3,018.51
₿0.050
$28.15K
₿0.83
$0
$0
₿0
Eth 2.0 Staking by Pool-X(eth2)-Preisprognose
Liquid Staking Dot  LDOT $1.04
₿0.000017
7.45 $0
₿0
$1.05
₿0.000018
$0.9487
₿0.000017
$174.48K
₿2.21
$0
$0
₿0
Liquid Staking Dot(ldot)-Preisprognose
Staked Thala APT  STHAPT $10.65
₿0.00018
6.98 $0
₿0
$10.72
₿0.00020
$9.76
₿0.00018
$487.79
₿0.1
$0
$0
₿0
Staked Thala APT(sthapt)-Preisprognose
Astrid Restaked stETH  RSTETH $51.85
₿0.0012
0 $0
₿0
$0
$0
$340.74
₿0.01
$0
$0
₿0
Astrid Restaked stETH(rsteth)-Preisprognose
Astrid Restaked rETH  RRETH $0
0 $0
$0
$0
$0
$0
$0
Astrid Restaked rETH(rreth)-Preisprognose
Astrid Restaked cbETH  RCBETH $0
0 $0
$0
$0
$0
$0
$0
Astrid Restaked cbETH(rcbeth)-Preisprognose
OKX Staked DOT2  OKDOT2 $7.57
₿0.00017
0 $0
₿0
$0
$0
$190.92
₿0
$0
$0
₿0
OKX Staked DOT2(okdot2)-Preisprognose
Crypto.com Staked ETH  CDCETH $3,204.29
₿0.051
2.21 $0
₿0
$3,213.84
₿0.052
$3,071.28
₿0.051
$143.32K
₿1.34
$0
$0
₿0
Crypto.com Staked ETH(cdceth)-Preisprognose
Stride Staked DYDX  STDYDX $2.5
₿0.000042
3.66 $0
₿0
$2.5
₿0.000044
$2.36
₿0.000040
$12.61K
₿1.03
$0
$0
₿0
Stride Staked DYDX(stdydx)-Preisprognose
BlazeStake Staked SOL  BSOL $169.38
₿0.0027
4.81 $0
₿0
$170.35
₿0.0028
$157.9
₿0.0027
$13.09M
₿193.27
$0
$0
₿0
BlazeStake Staked SOL(bsol)-Preisprognose
Staked KCS  SKCS $9.66
₿0.00016
4.25 $0
₿0
$9.78
₿0.00016
$9.25
₿0.00015
$416.6
₿0
$87.88K
₿1.49
$0
₿0
Staked KCS(skcs)-Preisprognose
Monsterra MAG  MAG $0.002023
₿0.000000034
0.87 $0
₿0
$0.002161
₿0.000000035
$0.002002
₿0.000000033
$39.71
₿0.01
$0
$0
₿0
Monsterra MAG(mag)-Preisprognose
Stride Staked Evmos  STEVMOS $0
0 $0
₿0
$0
$0
$67.07K
₿1.47
$2.23M
₿48.81
$0
₿0
Stride Staked Evmos(stevmos)-Preisprognose
Staked Ethos Reserve Note  STERN $1.04
₿0.000015
0.99 $0
₿0
$1.04
₿0.000015
$1.01
₿0.000014
$861.56
₿0.01
$0
$0
₿0
Staked Ethos Reserve Note(stern)-Preisprognose
MilkyWay Staked TIA  MILKTIA $12.02
₿0.00016
9.68 $0
₿0
$12.24
₿0.00017
$10.84
₿0.00016
$206.54K
₿3.9
$0
$0
₿0
MilkyWay Staked TIA(milktia)-Preisprognose
Orchai Protocol Staked Compound ATOM  SCATOM $0
0 $0
$0
$0
$0
$0
$0
Orchai Protocol Staked Compound ATOM(scatom)-Preisprognose
Anchor bETH Token  BETH $1,638.78
₿0.066
0 $0
₿0
$0
₿0.
$0
₿0.
$16.39
₿0
$0
$0
₿0
Anchor bETH Token(beth)-Preisprognose
Ankr Staked BNB  ANKRBNB $614.58
₿0.0091
1.88 $0
₿0
$617.48
₿0.0091
$592.17
₿0.0088
$363.15K
₿32.94
$199.9M
₿2.97K
$0
₿0
Ankr Staked BNB(ankrbnb)-Preisprognose
Leveraged rETH Staking Yield  ICRETH $2,203.35
₿0.060
0 $0
₿0
$0
$0
$887.59
₿0.02
$0
$0
₿0
Leveraged rETH Staking Yield(icreth)-Preisprognose
Eris Staked Kuji  AMPKUJI $2.33
₿0.000034
16.96 $0
₿0
$2.33
₿0.000035
$1.98
₿0.000033
$990.48
₿0.01
$2.93M
₿43.71
$0
₿0
Eris Staked Kuji(ampkuji)-Preisprognose
PEPE.bet  PEPEBET $0.00001684
₿0.00000000067
0 $0
₿0
$0
₿0.
$0
₿0.
$699.7
₿0
$16.84K
₿0.67
$0
₿0
PEPE.bet(pepebet)-Preisprognose
rETH  RETH $3,344.93
₿0.054
2.26 $0
₿0
$3,345.14
₿0.055
$3,262.62
₿0.054
$65.76
₿0.01
$8.64M
₿144.58
$0
₿0
rETH(reth)-Preisprognose
SafeStake  DVT $0.08556
₿0.0000014
-1.54 $0
₿0
$0.08692
₿0.0000014
$0.08482
₿0.0000014
$154.02
₿0
$8.56M
₿141.83
$0
₿0
SafeStake(dvt)-Preisprognose
Dinero Staked ETH  PXETH $3,138.17
₿0.050
1.64 $0
₿0
$3,152.25
₿0.051
$3,015.14
₿0.050
$311.01K
₿1.24
$23.02M
₿369.71
$0
₿0
Dinero Staked ETH(pxeth)-Preisprognose
Ditto Staked Aptos  STAPT $10.24
₿0.00017
7.20 $0
₿0
$10.29
₿0.00019
$9.38
₿0.00017
$53.14K
₿0.07
$504.76K
₿8.41
$0
₿0
Ditto Staked Aptos(stapt)-Preisprognose
Stride Staked Umee  STUMEE $0.004089
₿0.000000070
-2.57 $0
₿0
$0.004197
₿0.000000072
$0.003983
₿0.000000069
$837.43
₿0
$0
$0
₿0
Stride Staked Umee(stumee)-Preisprognose
Stride Staked Sommelier  STSOMM $0.1183
₿0.0000023
3.34 $0
₿0
$0.1189
₿0.0000025
$0.1105
₿0.0000022
$3.14
₿0
$0
$0
₿0
Stride Staked Sommelier(stsomm)-Preisprognose
Stride Staked Comdex  STCMDX $0.03046
₿0.00000057
1.26 $0
₿0
$0.03075
₿0.00000057
$0.02973
₿0.00000057
$10.23
₿0
$0
$0
₿0
Stride Staked Comdex(stcmdx)-Preisprognose
Nexus bLuna token share representation  NLUNA $0.0002778
₿0.000000012
0 $0
₿0
$0
₿0.
$0
₿0.
$41.12
₿0
$0
$0
₿0
Nexus bLuna token share representation(nLuna)-Preisprognose
Staked Luna  STLUNA $0.0001466
₿0.0000000056
0 $17.97K
₿0.69
$0
₿0.
$0
₿0.
$2.24K
₿0
$0
$17.97K
₿0.69
Staked Luna(stluna)-Preisprognose
Lista Staked BNB  SLISBNB $570.85
₿0.0086
1.93 $0
₿0
$580.57
₿0.0086
$548.67
₿0.0083
$1.6M
₿4.84
$0
$0
₿0
Lista Staked BNB(slisbnb)-Preisprognose
pSTAKE Staked BNB  STKBNB $594.85
₿0.0088
2.15 $0
₿0
$597.86
₿0.0088
$572.64
₿0.0085
$4.19K
₿4.75
$676.32K
₿161.78
$0
₿0
pSTAKE Staked BNB(stkbnb)-Preisprognose
Staked TLOS  STLOS $0.3674
₿0.0000054
-7.49 $0
₿0
$0.4008
₿0.0000056
$0.3642
₿0.0000053
$4.73K
₿0.19
$0
$0
₿0
Staked TLOS(stlos)-Preisprognose
Quark Protocol Staked MNTA  QCMNTA $0
0 $0
$0
₿0.
$0
₿0.
$0
₿0
$0
$0
Quark Protocol Staked MNTA(qcmnta)-Preisprognose
voucher ETH  VETH $1,716.73
₿0.066
0 $0
₿0
$0
₿0.
$0
₿0.
$22.92
₿0
$31.14M
₿1.2K
$0
₿0
voucher ETH(veth)-Preisprognose
Quark Protocol Staked KUJI  QCKUJI $0
0 $0
$0
₿0.
$0
₿0.
$0
₿0
$0
$0
Quark Protocol Staked KUJI(qckuji)-Preisprognose
Quark Protocol Staked MNTA  QCMNTA $0.3763
₿0.0000070
4.75 $0
₿0
$0.3763
₿0.0000072
$0.3538
₿0.0000070
$0.08
₿0
$0
$0
₿0
Quark Protocol Staked MNTA(qcmnta)-Preisprognose
Quark Protocol Staked KUJI  QCKUJI $2.25
₿0.000033
18.13 $0
₿0
$2.25
₿0.000034
$1.9
₿0.000032
$40.94
₿0
$0
$0
₿0
Quark Protocol Staked KUJI(qckuji)-Preisprognose
StaFi Staked SOL  RSOL $0
0 $0
$0
$0
$0
$0
$0
StaFi Staked SOL(rsol)-Preisprognose
Lido Staked Matic  STMATIC $0.8211
₿0.000014
8.99 $0
₿0
$0.8222
₿0.000014
$0.741
₿0.000014
$1.14M
₿2.46
$460.04K
₿7.96
$0
₿0
Lido Staked Matic(stmatic)-Preisprognose
Aftermath Staked SUI  AFSUI $1.44
₿0.000022
5.05 $0
₿0
$1.44
₿0.000023
$1.33
₿0.000021
$129.58K
₿0.83
$0
$0
₿0
Aftermath Staked SUI(afsui)-Preisprognose
Staked TRX  STRX $0.1194
₿0.0000018
-0.13 $0
₿0
$0.1196
₿0.0000019
$0.1186
₿0.0000018
$1.19
₿0
$41.04M
₿645.22
$0
₿0
Staked TRX(strx)-Preisprognose
Tranquil Staked ONE  STONE $0.02405
₿0.00000043
10.75 $0
₿0
$0.02497
₿0.00000046
$0.02171
₿0.00000043
$142.85
₿0
$701.37K
₿12.7
$0
₿0
Tranquil Staked ONE(stone)-Preisprognose
Staked USDT  STUSDT $0.9946
₿0.000014
-0.05 $0
₿0
$0.9994
₿0.000014
$0.9914
₿0.000014
$0.69
₿0
$0
$0
₿0
Staked USDT(stusdt)-Preisprognose
Tortuga Staked Aptos  TAPT $11.11
₿0.000067
6.51 $0
₿0
$11.2
₿0.00021
$10.17
₿0.000064
$4.38K
₿0.12
$0
$0
₿0
Tortuga Staked Aptos(tapt)-Preisprognose
Ankr Staked MATIC  ANKRMATIC $0.8589
₿0.000014
9.01 $0
₿0
$0.8623
₿0.000015
$0.7725
₿0.000014
$597.47
₿0.01
$405.86K
₿7.02
$0
₿0
Ankr Staked MATIC(ankrmatic)-Preisprognose
pSTAKE Staked ATOM  STKATOM $10.75
₿0.00019
5.37 $0
₿0
$10.77
₿0.00019
$10.09
₿0.00019
$1.23K
₿0.38
$5.63M
₿101.07
$0
₿0
pSTAKE Staked ATOM(stkatom)-Preisprognose
Amulet Staked SOL  AMTSOL $152.29
₿0.0027
0 $0
₿0
$0
$0
$11.61
₿0
$1.04M
₿19.03
$0
₿0
Amulet Staked SOL(amtsol)-Preisprognose
Keine Favoritenmünzen

Sie haben noch keine Lieblings-Kryptowährungen, bitte fügen Sie sie zu den Favoriten hinzu, um sie hier zu sehen